C31H31F3O6 — CID 10578706
[(8Z,10R)-4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),8,15,18-heptaen-10-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10578706) has the molecular formula C31H31F3O6 and a molecular weight of 556.58 g/mol. Its IUPAC name is [(8Z,10R)-4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),8,15,18-heptaen-10-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(8Z,10R)-4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),8,15,18-heptaen-10-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10578706 |
| Molecular Formula | C31H31F3O6 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | [(8Z,10R)-4,5-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),8,15,18-heptaen-10-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COc1cc2cc(c1OC)Oc1ccc(cc1)CCCC[C@@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)/C=C\2 |
| InChI | InChI=1S/C31H31F3O6/c1-36-26-19-22-15-18-24(40-29(35)30(38-3,31(32,33)34)23-10-5-4-6-11-23)12-8-7-9-21-13-16-25(17-14-21)39-27(20-22)28(26)37-2/h4-6,10-11,13-20,24H,7-9,12H2,1-3H3/b18-15-/t24-,30-/m1/s1 |
| InChIKey | WCXHXHDIJFLGOX-HNVPJXDNSA-N |
| XLogP | 7.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |