C21H22O5 — CID 71658529
(11E)-12-hydroxy-4,6-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one (PubChem CID 71658529) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is (11E)-12-hydroxy-4,6-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one.
| Compound Name | (11E)-12-hydroxy-4,6-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one |
|---|---|
| PubChem CID | 71658529 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (11E)-12-hydroxy-4,6-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one |
| SMILES | COc1cc(OC)c2cc1CCC(=O)/C=C(/O)CCc1ccc(cc1)O2 |
| InChI | InChI=1S/C21H22O5/c1-24-19-13-20(25-2)21-11-15(19)6-8-17(23)12-16(22)7-3-14-4-9-18(26-21)10-5-14/h4-5,9-13,22H,3,6-8H2,1-2H3/b16-12+ |
| InChIKey | HLHJTKXZUQQQSV-FOWTUZBSSA-N |
| XLogP | 4.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |