C21H22O4 — CID 71658799
(11Z)-5,12-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one (PubChem CID 71658799) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is (11Z)-5,12-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one.
| Compound Name | (11Z)-5,12-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one |
|---|---|
| PubChem CID | 71658799 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (11Z)-5,12-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),11,15,18-heptaen-10-one |
| SMILES | CO/C1=C\C(=O)CCc2cc(OC)cc(c2)Oc2ccc(cc2)CC1 |
| InChI | InChI=1S/C21H22O4/c1-23-19-10-6-15-4-8-18(9-5-15)25-21-12-16(3-7-17(22)13-19)11-20(14-21)24-2/h4-5,8-9,11-14H,3,6-7,10H2,1-2H3/b19-13- |
| InChIKey | AWWQEQKBBNXGGQ-UYRXBGFRSA-N |
| XLogP | 4.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |