C16H17NO3 — CID 170746159
3,8-dimethoxy-5-methyl-1,2-dihydrophenanthridin-6-one (PubChem CID 170746159) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3,8-dimethoxy-5-methyl-1,2-dihydrophenanthridin-6-one.
| Compound Name | 3,8-dimethoxy-5-methyl-1,2-dihydrophenanthridin-6-one |
|---|---|
| PubChem CID | 170746159 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3,8-dimethoxy-5-methyl-1,2-dihydrophenanthridin-6-one |
| SMILES | COC1=Cc2c(c3ccc(OC)cc3c(=O)n2C)CC1 |
| InChI | InChI=1S/C16H17NO3/c1-17-15-9-11(20-3)5-7-13(15)12-6-4-10(19-2)8-14(12)16(17)18/h4,6,8-9H,5,7H2,1-3H3 |
| InChIKey | KOIAWAFUFQRMOH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |