C15H15NO2 — CID 134892334
6-methoxy-10-methyl-1,2-dihydroacridin-9-one (PubChem CID 134892334) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 6-methoxy-10-methyl-1,2-dihydroacridin-9-one.
| Compound Name | 6-methoxy-10-methyl-1,2-dihydroacridin-9-one |
|---|---|
| PubChem CID | 134892334 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-methoxy-10-methyl-1,2-dihydroacridin-9-one |
| SMILES | COc1ccc2c(=O)c3c(n(C)c2c1)C=CCC3 |
| InChI | InChI=1S/C15H15NO2/c1-16-13-6-4-3-5-11(13)15(17)12-8-7-10(18-2)9-14(12)16/h4,6-9H,3,5H2,1-2H3 |
| InChIKey | RTXXUTIPONVPNZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |