C24H27FN6O4 — CID 72946001
11-(2-fluoro-3,5-dimethoxyphenyl)-13-methyl-4-(4-methylpiperazine-1-carbonyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 72946001) has the molecular formula C24H27FN6O4 and a molecular weight of 482.52 g/mol. Its IUPAC name is 11-(2-fluoro-3,5-dimethoxyphenyl)-13-methyl-4-(4-methylpiperazine-1-carbonyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 11-(2-fluoro-3,5-dimethoxyphenyl)-13-methyl-4-(4-methylpiperazine-1-carbonyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 72946001 |
| Molecular Formula | C24H27FN6O4 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 11-(2-fluoro-3,5-dimethoxyphenyl)-13-methyl-4-(4-methylpiperazine-1-carbonyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]c(C(=O)N5CCN(C)CC5)cc4c3N(C)C2=O)c1 |
| InChI | InChI=1S/C24H27FN6O4/c1-28-5-7-30(8-6-28)23(32)17-11-16-21-14(12-26-22(16)27-17)13-31(24(33)29(21)2)18-9-15(34-3)10-19(35-4)20(18)25/h9-12H,5-8,13H2,1-4H3,(H,26,27) |
| InChIKey | HWLSHVOERCKNMJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |