C32H25BrCl4N8O2 — CID 72946288
2-[bis[[1-[(4-chlorophenyl)methyl]triazol-4-yl]methyl]amino]-6-bromobenzo[de]isoquinoline-1,3-dione;dihydrochloride (PubChem CID 72946288) has the molecular formula C32H25BrCl4N8O2 and a molecular weight of 775.32 g/mol. Its IUPAC name is 2-[bis[[1-[(4-chlorophenyl)methyl]triazol-4-yl]methyl]amino]-6-bromobenzo[de]isoquinoline-1,3-dione;dihydrochloride.
| Compound Name | 2-[bis[[1-[(4-chlorophenyl)methyl]triazol-4-yl]methyl]amino]-6-bromobenzo[de]isoquinoline-1,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 72946288 |
| Molecular Formula | C32H25BrCl4N8O2 |
| Molecular Weight | 775.32 g/mol |
| Exact Mass | 772.00 |
| IUPAC Name | 2-[bis[[1-[(4-chlorophenyl)methyl]triazol-4-yl]methyl]amino]-6-bromobenzo[de]isoquinoline-1,3-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C1c2cccc3c(Br)ccc(c23)C(=O)N1N(Cc1cn(Cc2ccc(Cl)cc2)nn1)Cc1cn(Cc2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C32H23BrCl2N8O2.2ClH/c33-29-13-12-28-30-26(29)2-1-3-27(30)31(44)43(32(28)45)42(18-24-16-40(38-36-24)14-20-4-8-22(34)9-5-20)19-25-17-41(39-37-25)15-21-6-10-23(35)11-7-21;;/h1-13,16-17H,14-15,18-19H2;2*1H |
| InChIKey | KCIXQCTYMQDYIT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 102.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.32 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|