C32H25BrCl2N10O6 — CID 72946670
2-[bis[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methyl]amino]-6-bromobenzo[de]isoquinoline-1,3-dione;dihydrochloride (PubChem CID 72946670) has the molecular formula C32H25BrCl2N10O6 and a molecular weight of 796.43 g/mol. Its IUPAC name is 2-[bis[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methyl]amino]-6-bromobenzo[de]isoquinoline-1,3-dione;dihydrochloride.
| Compound Name | 2-[bis[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methyl]amino]-6-bromobenzo[de]isoquinoline-1,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 72946670 |
| Molecular Formula | C32H25BrCl2N10O6 |
| Molecular Weight | 796.43 g/mol |
| Exact Mass | 794.05 |
| IUPAC Name | 2-[bis[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methyl]amino]-6-bromobenzo[de]isoquinoline-1,3-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C1c2cccc3c(Br)ccc(c23)C(=O)N1N(Cc1cn(Cc2ccc([N+](=O)[O-])cc2)nn1)Cc1cn(Cc2ccc([N+](=O)[O-])cc2)nn1 |
| InChI | InChI=1S/C32H23BrN10O6.2ClH/c33-29-13-12-28-30-26(29)2-1-3-27(30)31(44)41(32(28)45)40(18-22-16-38(36-34-22)14-20-4-8-24(9-5-20)42(46)47)19-23-17-39(37-35-23)15-21-6-10-25(11-7-21)43(48)49;;/h1-13,16-17H,14-15,18-19H2;2*1H |
| InChIKey | GDPUWFQRUYFOLJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 188.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|