C23H18N6O3 — CID 71732261
2-[2-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]-1H-benzimidazole (PubChem CID 71732261) has the molecular formula C23H18N6O3 and a molecular weight of 426.44 g/mol. Its IUPAC name is 2-[2-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]-1H-benzimidazole.
| Compound Name | 2-[2-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 71732261 |
| Molecular Formula | C23H18N6O3 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-[2-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc(Cn2cc(COc3ccccc3-c3nc4ccccc4[nH]3)nn2)cc1 |
| InChI | InChI=1S/C23H18N6O3/c30-29(31)18-11-9-16(10-12-18)13-28-14-17(26-27-28)15-32-22-8-4-1-5-19(22)23-24-20-6-2-3-7-21(20)25-23/h1-12,14H,13,15H2,(H,24,25) |
| InChIKey | PNWJICYPNCBONZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|