C24H18ClN7O3 — CID 162643587
N-(3-chlorophenyl)-8-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]quinazolin-2-amine (PubChem CID 162643587) has the molecular formula C24H18ClN7O3 and a molecular weight of 487.91 g/mol. Its IUPAC name is N-(3-chlorophenyl)-8-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]quinazolin-2-amine.
| Compound Name | N-(3-chlorophenyl)-8-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]quinazolin-2-amine |
|---|---|
| PubChem CID | 162643587 |
| Molecular Formula | C24H18ClN7O3 |
| Molecular Weight | 487.91 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-(3-chlorophenyl)-8-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]quinazolin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Cn2cc(COc3cccc4cnc(Nc5cccc(Cl)c5)nc34)nn2)cc1 |
| InChI | InChI=1S/C24H18ClN7O3/c25-18-4-2-5-19(11-18)27-24-26-12-17-3-1-6-22(23(17)28-24)35-15-20-14-31(30-29-20)13-16-7-9-21(10-8-16)32(33)34/h1-12,14H,13,15H2,(H,26,27,28) |
| InChIKey | RVSNATJEWFQPOJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.91 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|