C27H25N7O4 — CID 163297343
2,7-dimethyl-N-[[4-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 163297343) has the molecular formula C27H25N7O4 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2,7-dimethyl-N-[[4-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2,7-dimethyl-N-[[4-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163297343 |
| Molecular Formula | C27H25N7O4 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 2,7-dimethyl-N-[[4-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccn2c(C(=O)NCc3ccc(OCc4cn(Cc5ccc([N+](=O)[O-])cc5)nn4)cc3)c(C)nc2c1 |
| InChI | InChI=1S/C27H25N7O4/c1-18-11-12-33-25(13-18)29-19(2)26(33)27(35)28-14-20-5-9-24(10-6-20)38-17-22-16-32(31-30-22)15-21-3-7-23(8-4-21)34(36)37/h3-13,16H,14-15,17H2,1-2H3,(H,28,35) |
| InChIKey | FZWGYANMNAJCAN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|