C24H19Br2N5O4 — CID 166347389
N-[(3,5-dibromophenyl)methyl]-3-[[4-[(4-nitrophenoxy)methyl]triazol-1-yl]methyl]benzamide (PubChem CID 166347389) has the molecular formula C24H19Br2N5O4 and a molecular weight of 601.26 g/mol. Its IUPAC name is N-[(3,5-dibromophenyl)methyl]-3-[[4-[(4-nitrophenoxy)methyl]triazol-1-yl]methyl]benzamide.
| Compound Name | N-[(3,5-dibromophenyl)methyl]-3-[[4-[(4-nitrophenoxy)methyl]triazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 166347389 |
| Molecular Formula | C24H19Br2N5O4 |
| Molecular Weight | 601.26 g/mol |
| Exact Mass | 598.98 |
| IUPAC Name | N-[(3,5-dibromophenyl)methyl]-3-[[4-[(4-nitrophenoxy)methyl]triazol-1-yl]methyl]benzamide |
| SMILES | O=C(NCc1cc(Br)cc(Br)c1)c1cccc(Cn2cc(COc3ccc([N+](=O)[O-])cc3)nn2)c1 |
| InChI | InChI=1S/C24H19Br2N5O4/c25-19-9-17(10-20(26)11-19)12-27-24(32)18-3-1-2-16(8-18)13-30-14-21(28-29-30)15-35-23-6-4-22(5-7-23)31(33)34/h1-11,14H,12-13,15H2,(H,27,32) |
| InChIKey | STEQABMUGQRNPK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|