C18H18N4O4 — CID 134154995
2,7-dimethyl-N-[2-(3-nitrophenoxy)ethyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 134154995) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2,7-dimethyl-N-[2-(3-nitrophenoxy)ethyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2,7-dimethyl-N-[2-(3-nitrophenoxy)ethyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134154995 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2,7-dimethyl-N-[2-(3-nitrophenoxy)ethyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccn2c(C(=O)NCCOc3cccc([N+](=O)[O-])c3)c(C)nc2c1 |
| InChI | InChI=1S/C18H18N4O4/c1-12-6-8-21-16(10-12)20-13(2)17(21)18(23)19-7-9-26-15-5-3-4-14(11-15)22(24)25/h3-6,8,10-11H,7,9H2,1-2H3,(H,19,23) |
| InChIKey | QCZJOCLBZYEOBP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|