C17H19N3O2 — CID 56759259
N-[3-(furan-2-yl)propyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 56759259) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[3-(furan-2-yl)propyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[3-(furan-2-yl)propyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56759259 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[3-(furan-2-yl)propyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccn2c(C(=O)NCCCc3ccco3)c(C)nc2c1 |
| InChI | InChI=1S/C17H19N3O2/c1-12-7-9-20-15(11-12)19-13(2)16(20)17(21)18-8-3-5-14-6-4-10-22-14/h4,6-7,9-11H,3,5,8H2,1-2H3,(H,18,21) |
| InChIKey | WITDQGANIVSODW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|