C15H22N2O — CID 72946609
(1R,2R,9S,17R)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-15-en-6-one (PubChem CID 72946609) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (1R,2R,9S,17R)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-15-en-6-one.
| Compound Name | (1R,2R,9S,17R)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-15-en-6-one |
|---|---|
| PubChem CID | 72946609 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (1R,2R,9S,17R)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-15-en-6-one |
| SMILES | O=C1CCC[C@@H]2[C@H]3C=CCN4CCC[C@@H](CN12)[C@H]34 |
| InChI | InChI=1S/C15H22N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h3,5,11-13,15H,1-2,4,6-10H2/t11-,12+,13+,15+/m0/s1 |
| InChIKey | RYVZWSLMVNZZSI-KYEXWDHISA-N |
| XLogP | 1.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|