C14H8Cl2F4N2O5S — CID 72949786
5-chloro-4-[3-chloro-4-(trifluoromethoxy)phenoxy]-2-fluoro-N-sulfamoylbenzamide (PubChem CID 72949786) has the molecular formula C14H8Cl2F4N2O5S and a molecular weight of 463.19 g/mol. Its IUPAC name is 5-chloro-4-[3-chloro-4-(trifluoromethoxy)phenoxy]-2-fluoro-N-sulfamoylbenzamide.
| Compound Name | 5-chloro-4-[3-chloro-4-(trifluoromethoxy)phenoxy]-2-fluoro-N-sulfamoylbenzamide |
|---|---|
| PubChem CID | 72949786 |
| Molecular Formula | C14H8Cl2F4N2O5S |
| Molecular Weight | 463.19 g/mol |
| Exact Mass | 461.95 |
| IUPAC Name | 5-chloro-4-[3-chloro-4-(trifluoromethoxy)phenoxy]-2-fluoro-N-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)NC(=O)c1cc(Cl)c(Oc2ccc(OC(F)(F)F)c(Cl)c2)cc1F |
| InChI | InChI=1S/C14H8Cl2F4N2O5S/c15-8-3-6(1-2-11(8)27-14(18,19)20)26-12-5-10(17)7(4-9(12)16)13(23)22-28(21,24)25/h1-5H,(H,22,23)(H2,21,24,25) |
| InChIKey | FAHRALHWJZLDOT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |