C22H20ClF3N6O2 — CID 72949949
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[4-(1H-pyrazole-5-carbonyl)piperazin-1-yl]phenyl]urea (PubChem CID 72949949) has the molecular formula C22H20ClF3N6O2 and a molecular weight of 492.89 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[4-(1H-pyrazole-5-carbonyl)piperazin-1-yl]phenyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[4-(1H-pyrazole-5-carbonyl)piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 72949949 |
| Molecular Formula | C22H20ClF3N6O2 |
| Molecular Weight | 492.89 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[4-(1H-pyrazole-5-carbonyl)piperazin-1-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccn[nH]3)CC2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20ClF3N6O2/c23-18-6-3-15(13-17(18)22(24,25)26)29-21(34)28-14-1-4-16(5-2-14)31-9-11-32(12-10-31)20(33)19-7-8-27-30-19/h1-8,13H,9-12H2,(H,27,30)(H2,28,29,34) |
| InChIKey | VKFUORIMFHXJBF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|