C18H21NO3 — CID 72965961
11-methoxy-14-[2-(methylamino)ethyl]-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,6,8(13),9,11-pentaen-2-ol (PubChem CID 72965961) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 11-methoxy-14-[2-(methylamino)ethyl]-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,6,8(13),9,11-pentaen-2-ol.
| Compound Name | 11-methoxy-14-[2-(methylamino)ethyl]-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,6,8(13),9,11-pentaen-2-ol |
|---|---|
| PubChem CID | 72965961 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 11-methoxy-14-[2-(methylamino)ethyl]-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,6,8(13),9,11-pentaen-2-ol |
| SMILES | CNCCC12c3c4ccc(OC)c3OC1C(O)C=CC2C=C4 |
| InChI | InChI=1S/C18H21NO3/c1-19-10-9-18-12-5-3-11-4-8-14(21-2)16(15(11)18)22-17(18)13(20)7-6-12/h3-8,12-13,17,19-20H,9-10H2,1-2H3 |
| InChIKey | UYZBEQLUPPXGCM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|