C21H18F3NO7S2 — CID 72968094
[12,13-dihydroxy-4-(4-methylphenyl)sulfonyl-4-azatetracyclo[9.2.1.02,10.03,7]tetradeca-2,5,7,9-tetraen-9-yl] trifluoromethanesulfonate (PubChem CID 72968094) has the molecular formula C21H18F3NO7S2 and a molecular weight of 517.50 g/mol. Its IUPAC name is [12,13-dihydroxy-4-(4-methylphenyl)sulfonyl-4-azatetracyclo[9.2.1.02,10.03,7]tetradeca-2,5,7,9-tetraen-9-yl] trifluoromethanesulfonate.
| Compound Name | [12,13-dihydroxy-4-(4-methylphenyl)sulfonyl-4-azatetracyclo[9.2.1.02,10.03,7]tetradeca-2,5,7,9-tetraen-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 72968094 |
| Molecular Formula | C21H18F3NO7S2 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | [12,13-dihydroxy-4-(4-methylphenyl)sulfonyl-4-azatetracyclo[9.2.1.02,10.03,7]tetradeca-2,5,7,9-tetraen-9-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3cc(OS(=O)(=O)C(F)(F)F)c4c(c32)C2CC4C(O)C2O)cc1 |
| InChI | InChI=1S/C21H18F3NO7S2/c1-10-2-4-12(5-3-10)33(28,29)25-7-6-11-8-15(32-34(30,31)21(22,23)24)16-13-9-14(17(16)18(11)25)20(27)19(13)26/h2-8,13-14,19-20,26-27H,9H2,1H3 |
| InChIKey | GQONWUMFDGRPSM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|