C25H27NO4S — CID 135018064
8,9,14,14-tetramethyl-4-(4-methylphenyl)sulfonyl-13,15-dioxa-4-azapentacyclo[9.5.1.02,10.03,7.012,16]heptadeca-2(10),3(7),5,8-tetraene (PubChem CID 135018064) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is 8,9,14,14-tetramethyl-4-(4-methylphenyl)sulfonyl-13,15-dioxa-4-azapentacyclo[9.5.1.02,10.03,7.012,16]heptadeca-2(10),3(7),5,8-tetraene.
| Compound Name | 8,9,14,14-tetramethyl-4-(4-methylphenyl)sulfonyl-13,15-dioxa-4-azapentacyclo[9.5.1.02,10.03,7.012,16]heptadeca-2(10),3(7),5,8-tetraene |
|---|---|
| PubChem CID | 135018064 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 8,9,14,14-tetramethyl-4-(4-methylphenyl)sulfonyl-13,15-dioxa-4-azapentacyclo[9.5.1.02,10.03,7.012,16]heptadeca-2(10),3(7),5,8-tetraene |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(C)c(C)c4c(c32)C2CC4C3OC(C)(C)OC23)cc1 |
| InChI | InChI=1S/C25H27NO4S/c1-13-6-8-16(9-7-13)31(27,28)26-11-10-17-14(2)15(3)20-18-12-19(21(20)22(17)26)24-23(18)29-25(4,5)30-24/h6-11,18-19,23-24H,12H2,1-5H3 |
| InChIKey | LUEJIAZIECDTRU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |