C18H25N2O2S+ — CID 7296842
[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-(2-methoxyethyl)azanium (PubChem CID 7296842) has the molecular formula C18H25N2O2S+ and a molecular weight of 333.48 g/mol. Its IUPAC name is [2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-(2-methoxyethyl)azanium.
| Compound Name | [2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 7296842 |
| Molecular Formula | C18H25N2O2S+ |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-(2-methoxyethyl)azanium |
| SMILES | COCC[NH2+]CC(=O)N(Cc1ccccc1)Cc1ccc(C)s1 |
| InChI | InChI=1S/C18H24N2O2S/c1-15-8-9-17(23-15)14-20(13-16-6-4-3-5-7-16)18(21)12-19-10-11-22-2/h3-9,19H,10-14H2,1-2H3/p+1 |
| InChIKey | AIIHCHHEOILUCE-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|