C14H24O3 — CID 72974282
4,8-dihydroxy-4a-methyl-7-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one (PubChem CID 72974282) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 4,8-dihydroxy-4a-methyl-7-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one.
| Compound Name | 4,8-dihydroxy-4a-methyl-7-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 72974282 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4,8-dihydroxy-4a-methyl-7-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
| SMILES | CC(C)C1CCC2(C)C(O)CCC(=O)C2C1O |
| InChI | InChI=1S/C14H24O3/c1-8(2)9-6-7-14(3)11(16)5-4-10(15)12(14)13(9)17/h8-9,11-13,16-17H,4-7H2,1-3H3 |
| InChIKey | OCVNGAWWQYKMBF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |