C16H26N2O3 — CID 7297504
N-[(2S)-butan-2-yl]-N-[3-(2-methylpropylamino)-3-oxopropyl]furan-3-carboxamide (PubChem CID 7297504) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N-[3-(2-methylpropylamino)-3-oxopropyl]furan-3-carboxamide.
| Compound Name | N-[(2S)-butan-2-yl]-N-[3-(2-methylpropylamino)-3-oxopropyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 7297504 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N-[3-(2-methylpropylamino)-3-oxopropyl]furan-3-carboxamide |
| SMILES | CC[C@H](C)N(CCC(=O)NCC(C)C)C(=O)c1ccoc1 |
| InChI | InChI=1S/C16H26N2O3/c1-5-13(4)18(16(20)14-7-9-21-11-14)8-6-15(19)17-10-12(2)3/h7,9,11-13H,5-6,8,10H2,1-4H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | CPYRBVDDKBGYHW-ZDUSSCGKSA-N |
| XLogP | 2.68 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |