C20H31ClN4O2 — CID 72980192
1,1-dibutyl-3-[1-(2-chloro-6-methylpyridine-3-carbonyl)pyrrolidin-3-yl]urea (PubChem CID 72980192) has the molecular formula C20H31ClN4O2 and a molecular weight of 394.95 g/mol. Its IUPAC name is 1,1-dibutyl-3-[1-(2-chloro-6-methylpyridine-3-carbonyl)pyrrolidin-3-yl]urea.
| Compound Name | 1,1-dibutyl-3-[1-(2-chloro-6-methylpyridine-3-carbonyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 72980192 |
| Molecular Formula | C20H31ClN4O2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 1,1-dibutyl-3-[1-(2-chloro-6-methylpyridine-3-carbonyl)pyrrolidin-3-yl]urea |
| SMILES | CCCCN(CCCC)C(=O)NC1CCN(C(=O)c2ccc(C)nc2Cl)C1 |
| InChI | InChI=1S/C20H31ClN4O2/c1-4-6-11-24(12-7-5-2)20(27)23-16-10-13-25(14-16)19(26)17-9-8-15(3)22-18(17)21/h8-9,16H,4-7,10-14H2,1-3H3,(H,23,27) |
| InChIKey | GDDDGPHPBDEZIW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|