C18H27ClN4O3 — CID 11485879
3-[(3R)-1-(2-chloro-6-methylpyridine-3-carbonyl)pyrrolidin-3-yl]-1-(2-methoxyethyl)-1-propan-2-ylurea (PubChem CID 11485879) has the molecular formula C18H27ClN4O3 and a molecular weight of 382.89 g/mol. Its IUPAC name is 3-[(3R)-1-(2-chloro-6-methylpyridine-3-carbonyl)pyrrolidin-3-yl]-1-(2-methoxyethyl)-1-propan-2-ylurea.
| Compound Name | 3-[(3R)-1-(2-chloro-6-methylpyridine-3-carbonyl)pyrrolidin-3-yl]-1-(2-methoxyethyl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 11485879 |
| Molecular Formula | C18H27ClN4O3 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-[(3R)-1-(2-chloro-6-methylpyridine-3-carbonyl)pyrrolidin-3-yl]-1-(2-methoxyethyl)-1-propan-2-ylurea |
| SMILES | COCCN(C(=O)N[C@@H]1CCN(C(=O)c2ccc(C)nc2Cl)C1)C(C)C |
| InChI | InChI=1S/C18H27ClN4O3/c1-12(2)23(9-10-26-4)18(25)21-14-7-8-22(11-14)17(24)15-6-5-13(3)20-16(15)19/h5-6,12,14H,7-11H2,1-4H3,(H,21,25)/t14-/m1/s1 |
| InChIKey | MNDNGGPDSAETQC-CQSZACIVSA-N |
| XLogP | 2.32 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|