C23H27NO3 — CID 7298133
ethyl 2-oxo-2-[(4S)-2,2,4,7-tetramethyl-4-phenyl-3H-quinolin-1-yl]acetate (PubChem CID 7298133) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is ethyl 2-oxo-2-[(4S)-2,2,4,7-tetramethyl-4-phenyl-3H-quinolin-1-yl]acetate.
| Compound Name | ethyl 2-oxo-2-[(4S)-2,2,4,7-tetramethyl-4-phenyl-3H-quinolin-1-yl]acetate |
|---|---|
| PubChem CID | 7298133 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | ethyl 2-oxo-2-[(4S)-2,2,4,7-tetramethyl-4-phenyl-3H-quinolin-1-yl]acetate |
| SMILES | CCOC(=O)C(=O)N1c2cc(C)ccc2[C@](C)(c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C23H27NO3/c1-6-27-21(26)20(25)24-19-14-16(2)12-13-18(19)23(5,15-22(24,3)4)17-10-8-7-9-11-17/h7-14H,6,15H2,1-5H3/t23-/m0/s1 |
| InChIKey | HVZCHUUCGHADMT-QHCPKHFHSA-N |
| XLogP | 4.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|