C25H24F2NOP — CID 72982768
[2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis(4-fluorophenyl)phosphane (PubChem CID 72982768) has the molecular formula C25H24F2NOP and a molecular weight of 423.44 g/mol. Its IUPAC name is [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis(4-fluorophenyl)phosphane.
| Compound Name | [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis(4-fluorophenyl)phosphane |
|---|---|
| PubChem CID | 72982768 |
| Molecular Formula | C25H24F2NOP |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [2-(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis(4-fluorophenyl)phosphane |
| SMILES | CC(C)(C)C1COC(c2ccccc2P(c2ccc(F)cc2)c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C25H24F2NOP/c1-25(2,3)23-16-29-24(28-23)21-6-4-5-7-22(21)30(19-12-8-17(26)9-13-19)20-14-10-18(27)11-15-20/h4-15,23H,16H2,1-3H3 |
| InChIKey | JWSNEALPJVGPLM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|