C32H38N2O5 — CID 72984477
2-ethoxy-3-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethoxy]phenyl]propanoic acid (PubChem CID 72984477) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 72984477 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN2CCC(C)(C)c3cc(C(=NOC)c4ccccc4)ccc32)cc1)C(=O)O |
| InChI | InChI=1S/C32H38N2O5/c1-5-38-29(31(35)36)21-23-11-14-26(15-12-23)39-20-19-34-18-17-32(2,3)27-22-25(13-16-28(27)34)30(33-37-4)24-9-7-6-8-10-24/h6-16,22,29H,5,17-21H2,1-4H3,(H,35,36) |
| InChIKey | XPMZAYBVAONKQR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|