C45H47N3O5 — CID 73005945
ethyl 2-(2-benzoylanilino)-3-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethoxy]phenyl]propanoate (PubChem CID 73005945) has the molecular formula C45H47N3O5 and a molecular weight of 709.89 g/mol. Its IUPAC name is ethyl 2-(2-benzoylanilino)-3-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethoxy]phenyl]propanoate.
| Compound Name | ethyl 2-(2-benzoylanilino)-3-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 73005945 |
| Molecular Formula | C45H47N3O5 |
| Molecular Weight | 709.89 g/mol |
| Exact Mass | 709.35 |
| IUPAC Name | ethyl 2-(2-benzoylanilino)-3-[4-[2-[6-(N-methoxy-C-phenylcarbonimidoyl)-4,4-dimethyl-2,3-dihydroquinolin-1-yl]ethoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCN2CCC(C)(C)c3cc(C(=NOC)c4ccccc4)ccc32)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C45H47N3O5/c1-5-52-44(50)40(46-39-19-13-12-18-37(39)43(49)34-16-10-7-11-17-34)30-32-20-23-36(24-21-32)53-29-28-48-27-26-45(2,3)38-31-35(22-25-41(38)48)42(47-51-4)33-14-8-6-9-15-33/h6-25,31,40,46H,5,26-30H2,1-4H3 |
| InChIKey | BECBLESYKOEHBS-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.89 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|