C16H24BrNO2 — CID 72991332
tert-butyl 4-bromo-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 72991332) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is tert-butyl 4-bromo-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-bromo-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 72991332 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | tert-butyl 4-bromo-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CCC1C=C(Br)CC(CC=C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24BrNO2/c1-6-8-13-10-12(17)11-14(9-7-2)18(13)15(19)20-16(3,4)5/h6-7,10,13-14H,1-2,8-9,11H2,3-5H3 |
| InChIKey | BATWFGGGRSPQHC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|