C20H26O6 — CID 72994054
4,9,10,15-tetrahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-2-en-7-one (PubChem CID 72994054) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is 4,9,10,15-tetrahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-2-en-7-one.
| Compound Name | 4,9,10,15-tetrahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-2-en-7-one |
|---|---|
| PubChem CID | 72994054 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4,9,10,15-tetrahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-2-en-7-one |
| SMILES | C=C1C(=O)C23CC1C(O)C=C2C12COC3(O)C(O)C1C(C)(C)CCC2O |
| InChI | InChI=1S/C20H26O6/c1-9-10-7-19(15(9)23)12(6-11(10)21)18-8-26-20(19,25)16(24)14(18)17(2,3)5-4-13(18)22/h6,10-11,13-14,16,21-22,24-25H,1,4-5,7-8H2,2-3H3 |
| InChIKey | SVTYNLHLUMQZRM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|