C31H42O7 — CID 90680845
[(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] adamantane-1-carboxylate (PubChem CID 90680845) has the molecular formula C31H42O7 and a molecular weight of 526.67 g/mol. Its IUPAC name is [(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] adamantane-1-carboxylate.
| Compound Name | [(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 90680845 |
| Molecular Formula | C31H42O7 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | [(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] adamantane-1-carboxylate |
| SMILES | C=C1C(=O)[C@]23[C@H](OC(=O)C45CC6CC(CC(C6)C4)C5)[C@H]1CC[C@H]2[C@@]12CO[C@]3(O)[C@@H](O)[C@@H]1C(C)(C)CC[C@@H]2O |
| InChI | InChI=1S/C31H42O7/c1-15-19-4-5-20-29-14-37-31(36,24(34)22(29)27(2,3)7-6-21(29)32)30(20,23(15)33)25(19)38-26(35)28-11-16-8-17(12-28)10-18(9-16)13-28/h16-22,24-25,32,34,36H,1,4-14H2,2-3H3/t16?,17?,18?,19-,20-,21-,22+,24-,25+,28?,29+,30-,31+/m0/s1 |
| InChIKey | XQIVUTONIGNRAN-AEAUSHKVSA-N |
| XLogP | 3.14 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|