C24H32O8 — CID 162899599
(18-acetyloxy-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-15-yl) acetate (PubChem CID 162899599) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is (18-acetyloxy-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-15-yl) acetate.
| Compound Name | (18-acetyloxy-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-15-yl) acetate |
|---|---|
| PubChem CID | 162899599 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (18-acetyloxy-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-15-yl) acetate |
| SMILES | C=C1C(=O)C23C(OC(C)=O)C1CCC2C12COC3(O)C(O)C1C(C)(C)CCC2OC(C)=O |
| InChI | InChI=1S/C24H32O8/c1-11-14-6-7-15-22-10-30-24(29,23(15,18(11)27)20(14)32-13(3)26)19(28)17(22)21(4,5)9-8-16(22)31-12(2)25/h14-17,19-20,28-29H,1,6-10H2,2-5H3 |
| InChIKey | AHBBDHRVZDAVTA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|