C29H33FO7 — CID 87055910
[(1S,5S,8R,9R,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 87055910) has the molecular formula C29H33FO7 and a molecular weight of 512.57 g/mol. Its IUPAC name is [(1S,5S,8R,9R,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [(1S,5S,8R,9R,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 87055910 |
| Molecular Formula | C29H33FO7 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | [(1S,5S,8R,9R,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | C=C1C(=O)[C@@]23C(CC[C@@H]1[C@H]2OC(=O)/C=C/c1ccc(F)cc1)[C@@]12CO[C@@]3(O)[C@@H](O)[C@@H]1C(C)(C)CC[C@@H]2O |
| InChI | InChI=1S/C29H33FO7/c1-15-18-9-10-19-27-14-36-29(35,24(34)22(27)26(2,3)13-12-20(27)31)28(19,23(15)33)25(18)37-21(32)11-6-16-4-7-17(30)8-5-16/h4-8,11,18-20,22,24-25,31,34-35H,1,9-10,12-14H2,2-3H3/b11-6+/t18-,19?,20-,22+,24-,25+,27+,28-,29-/m0/s1 |
| InChIKey | FHCMNOKMXVGBHJ-QMJAMSMLSA-N |
| XLogP | 2.78 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|