C30H35NO7 — CID 77106733
[(1S,5S,8R,9R,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 2-(1H-indol-3-yl)acetate (PubChem CID 77106733) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is [(1S,5S,8R,9R,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [(1S,5S,8R,9R,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 77106733 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | [(1S,5S,8R,9R,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 2-(1H-indol-3-yl)acetate |
| SMILES | C=C1C(=O)[C@@]23C(CC[C@@H]1[C@H]2OC(=O)Cc1c[nH]c2ccccc12)[C@@]12CO[C@@]3(O)[C@@H](O)[C@@H]1C(C)(C)CC[C@@H]2O |
| InChI | InChI=1S/C30H35NO7/c1-15-17-8-9-20-28-14-37-30(36,25(35)23(28)27(2,3)11-10-21(28)32)29(20,24(15)34)26(17)38-22(33)12-16-13-31-19-7-5-4-6-18(16)19/h4-7,13,17,20-21,23,25-26,31-32,35-36H,1,8-12,14H2,2-3H3/t17-,20?,21-,23+,25-,26+,28+,29-,30-/m0/s1 |
| InChIKey | ZMNNKNYSYVIWTM-FSXCHJKSSA-N |
| XLogP | 2.65 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|