C33H41Cl2NO8 — CID 86581085
[(9R,10S,11R,15S,18R)-15-acetyloxy-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-[bis(2-chloroethyl)amino]benzoate (PubChem CID 86581085) has the molecular formula C33H41Cl2NO8 and a molecular weight of 650.60 g/mol. Its IUPAC name is [(9R,10S,11R,15S,18R)-15-acetyloxy-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-[bis(2-chloroethyl)amino]benzoate.
| Compound Name | [(9R,10S,11R,15S,18R)-15-acetyloxy-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-[bis(2-chloroethyl)amino]benzoate |
|---|---|
| PubChem CID | 86581085 |
| Molecular Formula | C33H41Cl2NO8 |
| Molecular Weight | 650.60 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | [(9R,10S,11R,15S,18R)-15-acetyloxy-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-[bis(2-chloroethyl)amino]benzoate |
| SMILES | C=C1C(=O)C23C(CCC1[C@H]2OC(=O)c1ccc(N(CCCl)CCCl)cc1)C12CO[C@@]3(O)[C@@H](O)[C@@H]1C(C)(C)CC[C@@H]2OC(C)=O |
| InChI | InChI=1S/C33H41Cl2NO8/c1-18-22-9-10-23-31-17-42-33(41,27(39)25(31)30(3,4)12-11-24(31)43-19(2)37)32(23,26(18)38)28(22)44-29(40)20-5-7-21(8-6-20)36(15-13-34)16-14-35/h5-8,22-25,27-28,39,41H,1,9-17H2,2-4H3/t22?,23?,24-,25+,27-,28+,31?,32?,33-/m0/s1 |
| InChIKey | ZOWSEUAKSJUFHV-VSWWXISPSA-N |
| XLogP | 4.10 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|