C31H40O8 — CID 163867803
[(1R,2S,3S,4R,8S,9S,10S,13S,16R)-8-acetyloxy-2,3-dihydroxy-2-methoxy-5,5,9-trimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 4-methylbenzoate (PubChem CID 163867803) has the molecular formula C31H40O8 and a molecular weight of 540.65 g/mol. Its IUPAC name is [(1R,2S,3S,4R,8S,9S,10S,13S,16R)-8-acetyloxy-2,3-dihydroxy-2-methoxy-5,5,9-trimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 4-methylbenzoate.
| Compound Name | [(1R,2S,3S,4R,8S,9S,10S,13S,16R)-8-acetyloxy-2,3-dihydroxy-2-methoxy-5,5,9-trimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 163867803 |
| Molecular Formula | C31H40O8 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | [(1R,2S,3S,4R,8S,9S,10S,13S,16R)-8-acetyloxy-2,3-dihydroxy-2-methoxy-5,5,9-trimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 4-methylbenzoate |
| SMILES | C=C1C(=O)[C@]23[C@H](OC(=O)c4ccc(C)cc4)[C@H]1CC[C@H]2[C@]1(C)[C@@H](OC(C)=O)CCC(C)(C)[C@H]1[C@H](O)[C@@]3(O)OC |
| InChI | InChI=1S/C31H40O8/c1-16-8-10-19(11-9-16)27(35)39-26-20-12-13-21-29(6)22(38-18(3)32)14-15-28(4,5)23(29)25(34)31(36,37-7)30(21,26)24(33)17(20)2/h8-11,20-23,25-26,34,36H,2,12-15H2,1,3-7H3/t20-,21-,22-,23+,25-,26+,29+,30-,31+/m0/s1 |
| InChIKey | PIDWXNMATIOINI-NEWQAYJJSA-N |
| XLogP | 3.76 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|