C25H44N2O2 — CID 72999749
2-methoxy-N-[16-[methyl(pentyl)amino]hexadeca-5,8,11,14-tetraenyl]acetamide (PubChem CID 72999749) has the molecular formula C25H44N2O2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 2-methoxy-N-[16-[methyl(pentyl)amino]hexadeca-5,8,11,14-tetraenyl]acetamide.
| Compound Name | 2-methoxy-N-[16-[methyl(pentyl)amino]hexadeca-5,8,11,14-tetraenyl]acetamide |
|---|---|
| PubChem CID | 72999749 |
| Molecular Formula | C25H44N2O2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | 2-methoxy-N-[16-[methyl(pentyl)amino]hexadeca-5,8,11,14-tetraenyl]acetamide |
| SMILES | CCCCCN(C)CC=CCC=CCC=CCC=CCCCCNC(=O)COC |
| InChI | InChI=1S/C25H44N2O2/c1-4-5-19-22-27(2)23-20-17-15-13-11-9-7-6-8-10-12-14-16-18-21-26-25(28)24-29-3/h6-7,10-13,17,20H,4-5,8-9,14-16,18-19,21-24H2,1-3H3,(H,26,28) |
| InChIKey | OHZMMAMGYIESKI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|