C11H5ClF3NO2S — CID 73012743
4-chloro-2-[2-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carbaldehyde (PubChem CID 73012743) has the molecular formula C11H5ClF3NO2S and a molecular weight of 307.68 g/mol. Its IUPAC name is 4-chloro-2-[2-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-[2-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 73012743 |
| Molecular Formula | C11H5ClF3NO2S |
| Molecular Weight | 307.68 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | 4-chloro-2-[2-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1sc(Oc2ccccc2C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C11H5ClF3NO2S/c12-9-8(5-17)19-10(16-9)18-7-4-2-1-3-6(7)11(13,14)15/h1-5H |
| InChIKey | YCTZLENMVVFOMY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|