About 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one
4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 73018192) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one.
Molecular Properties
| Compound Name | 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
| PubChem CID | 73018192 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | COCCC1CNC(=O)c2cccn21 |
| InChI | InChI=1S/C10H14N2O2/c1-14-6-4-8-7-11-10(13)9-3-2-5-12(8)9/h2-3,5,8H,4,6-7H2,1H3,(H,11,13) |
| InChIKey | HNNRJILRFBFWQS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one?
The IUPAC name of 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one (CID 73018192) is 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one.
What is the SMILES notation for 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one?
The canonical SMILES for 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one is COCCC1CNC(=O)c2cccn21.
What is the InChIKey of 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one?
The InChIKey is HNNRJILRFBFWQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-14-6-4-8-7-11-10(13)9-3-2-5-12(8)9/h2-3,5,8H,4,6-7H2,1H3,(H,11,13).
What are the key properties of 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one?
4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one has a molecular weight of 194.23 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one is sourced from PubChem (CID 73018192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).