C23H37NO2 — CID 73026204
7-methoxy-N-(2-phenylethyl)tetradec-4-enamide (PubChem CID 73026204) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is 7-methoxy-N-(2-phenylethyl)tetradec-4-enamide.
| Compound Name | 7-methoxy-N-(2-phenylethyl)tetradec-4-enamide |
|---|---|
| PubChem CID | 73026204 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 7-methoxy-N-(2-phenylethyl)tetradec-4-enamide |
| SMILES | CCCCCCCC(CC=CCCC(=O)NCCc1ccccc1)OC |
| InChI | InChI=1S/C23H37NO2/c1-3-4-5-6-11-16-22(26-2)17-12-8-13-18-23(25)24-20-19-21-14-9-7-10-15-21/h7-10,12,14-15,22H,3-6,11,13,16-20H2,1-2H3,(H,24,25) |
| InChIKey | VPNLGLXHRKAYHD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|