C21H15ClN4O2 — CID 73050826
6-chloro-N-[phenyl-(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-2-carboxamide (PubChem CID 73050826) has the molecular formula C21H15ClN4O2 and a molecular weight of 390.83 g/mol. Its IUPAC name is 6-chloro-N-[phenyl-(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[phenyl-(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 73050826 |
| Molecular Formula | C21H15ClN4O2 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 6-chloro-N-[phenyl-(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1nc(-c2ccccc2)no1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C21H15ClN4O2/c22-17-13-7-12-16(23-17)20(27)24-18(14-8-3-1-4-9-14)21-25-19(26-28-21)15-10-5-2-6-11-15/h1-13,18H,(H,24,27) |
| InChIKey | FLVIJFCWWPGMLM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|