C21H17Cl2N5O — CID 121264482
N-amino-3,4-dichloro-N-[[phenyl-(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]amino]aniline (PubChem CID 121264482) has the molecular formula C21H17Cl2N5O and a molecular weight of 426.31 g/mol. Its IUPAC name is N-amino-3,4-dichloro-N-[[phenyl-(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]amino]aniline.
| Compound Name | N-amino-3,4-dichloro-N-[[phenyl-(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]amino]aniline |
|---|---|
| PubChem CID | 121264482 |
| Molecular Formula | C21H17Cl2N5O |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N-amino-3,4-dichloro-N-[[phenyl-(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]amino]aniline |
| SMILES | NN(NC(c1ccccc1)c1nc(-c2ccccc2)no1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2N5O/c22-17-12-11-16(13-18(17)23)28(24)26-19(14-7-3-1-4-8-14)21-25-20(27-29-21)15-9-5-2-6-10-15/h1-13,19,26H,24H2 |
| InChIKey | RKSWLUSHIKTIHR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|