C23H19N3O5S — CID 73053328
2-(3-cyano-4-cyclohexyloxyphenyl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 73053328) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is 2-(3-cyano-4-cyclohexyloxyphenyl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(3-cyano-4-cyclohexyloxyphenyl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 73053328 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-(3-cyano-4-cyclohexyloxyphenyl)-4-(4-nitrophenyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | N#Cc1cc(-c2nc(-c3ccc([N+](=O)[O-])cc3)c(C(=O)O)s2)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C23H19N3O5S/c24-13-16-12-15(8-11-19(16)31-18-4-2-1-3-5-18)22-25-20(21(32-22)23(27)28)14-6-9-17(10-7-14)26(29)30/h6-12,18H,1-5H2,(H,27,28) |
| InChIKey | NDTWRWVQIOSGOS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|