C27H47GaN7O13 — CID 73053592
CID 73053592 (PubChem CID 73053592) has the molecular formula C27H47GaN7O13 and a molecular weight of 745.64 g/mol.
| Compound Name | CID 73053592 |
|---|---|
| PubChem CID | 73053592 |
| Molecular Formula | C27H47GaN7O13 |
| Molecular Weight | 745.64 g/mol |
| Exact Mass | 745.25 |
| IUPAC Name | — |
| SMILES | NC(=O)CC[C@H](NC(=O)COCCOCCNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)C(=O)O.[68Ga] |
| InChI | InChI=1S/C27H47N7O13.Ga/c28-21(35)2-1-20(27(44)45)30-23(37)19-47-14-13-46-12-3-29-22(36)15-31-4-6-32(16-24(38)39)8-10-34(18-26(42)43)11-9-33(7-5-31)17-25(40)41;/h20H,1-19H2,(H2,28,35)(H,29,36)(H,30,37)(H,38,39)(H,40,41)(H,42,43)(H,44,45);/t20-;/m0./s1/i;1-2 |
| InChIKey | YFYVRAOSRYBLTD-ROONLMJFSA-N |
| XLogP | -4.93 |
| TPSA | 281.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.64 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|