C22H21N7OS — CID 73054495
1-[4-(8-morpholin-4-ylimidazo[1,2-b]pyridazin-6-yl)phenyl]-3-pyridin-3-ylthiourea (PubChem CID 73054495) has the molecular formula C22H21N7OS and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-[4-(8-morpholin-4-ylimidazo[1,2-b]pyridazin-6-yl)phenyl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[4-(8-morpholin-4-ylimidazo[1,2-b]pyridazin-6-yl)phenyl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 73054495 |
| Molecular Formula | C22H21N7OS |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 1-[4-(8-morpholin-4-ylimidazo[1,2-b]pyridazin-6-yl)phenyl]-3-pyridin-3-ylthiourea |
| SMILES | S=C(Nc1ccc(-c2cc(N3CCOCC3)c3nccn3n2)cc1)Nc1cccnc1 |
| InChI | InChI=1S/C22H21N7OS/c31-22(26-18-2-1-7-23-15-18)25-17-5-3-16(4-6-17)19-14-20(28-10-12-30-13-11-28)21-24-8-9-29(21)27-19/h1-9,14-15H,10-13H2,(H2,25,26,31) |
| InChIKey | BZMGEBGNOCMVSW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|