C26H25N7O2S — CID 76594500
1-[4-[4-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)morpholin-2-yl]phenyl]-3-pyridin-3-ylthiourea (PubChem CID 76594500) has the molecular formula C26H25N7O2S and a molecular weight of 499.60 g/mol. Its IUPAC name is 1-[4-[4-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)morpholin-2-yl]phenyl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[4-[4-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)morpholin-2-yl]phenyl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 76594500 |
| Molecular Formula | C26H25N7O2S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 1-[4-[4-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)morpholin-2-yl]phenyl]-3-pyridin-3-ylthiourea |
| SMILES | Cn1c(N2CCOC(c3ccc(NC(=S)Nc4cccnc4)cc3)C2)nc(-c2ccncc2)cc1=O |
| InChI | InChI=1S/C26H25N7O2S/c1-32-24(34)15-22(18-8-11-27-12-9-18)31-26(32)33-13-14-35-23(17-33)19-4-6-20(7-5-19)29-25(36)30-21-3-2-10-28-16-21/h2-12,15-16,23H,13-14,17H2,1H3,(H2,29,30,36) |
| InChIKey | HXZCPYYZCXWFFN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|