C25H31FN6O3 — CID 143207821
2-[2-[4-[ethyl-[(2-hydroxyethylamino)methyl]amino]phenyl]morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one (PubChem CID 143207821) has the molecular formula C25H31FN6O3 and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-[2-[4-[ethyl-[(2-hydroxyethylamino)methyl]amino]phenyl]morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one.
| Compound Name | 2-[2-[4-[ethyl-[(2-hydroxyethylamino)methyl]amino]phenyl]morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 143207821 |
| Molecular Formula | C25H31FN6O3 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 2-[2-[4-[ethyl-[(2-hydroxyethylamino)methyl]amino]phenyl]morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one |
| SMILES | CCN(CNCCO)c1ccc(C2CN(c3nc(-c4ccncc4F)cc(=O)n3C)CCO2)cc1 |
| InChI | InChI=1S/C25H31FN6O3/c1-3-31(17-28-10-12-33)19-6-4-18(5-7-19)23-16-32(11-13-35-23)25-29-22(14-24(34)30(25)2)20-8-9-27-15-21(20)26/h4-9,14-15,23,28,33H,3,10-13,16-17H2,1-2H3 |
| InChIKey | LFILMIHOHYTRDL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|