C31H40FN5O2 — CID 70822709
6-(3-fluoro-4-pyridinyl)-2-[(2S)-2-[4-(3-heptylpyrrolidin-1-yl)phenyl]morpholin-4-yl]-3-methylpyrimidin-4-one (PubChem CID 70822709) has the molecular formula C31H40FN5O2 and a molecular weight of 533.69 g/mol. Its IUPAC name is 6-(3-fluoro-4-pyridinyl)-2-[(2S)-2-[4-(3-heptylpyrrolidin-1-yl)phenyl]morpholin-4-yl]-3-methylpyrimidin-4-one.
| Compound Name | 6-(3-fluoro-4-pyridinyl)-2-[(2S)-2-[4-(3-heptylpyrrolidin-1-yl)phenyl]morpholin-4-yl]-3-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 70822709 |
| Molecular Formula | C31H40FN5O2 |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.32 |
| IUPAC Name | 6-(3-fluoro-4-pyridinyl)-2-[(2S)-2-[4-(3-heptylpyrrolidin-1-yl)phenyl]morpholin-4-yl]-3-methylpyrimidin-4-one |
| SMILES | CCCCCCCC1CCN(c2ccc([C@H]3CN(c4nc(-c5ccncc5F)cc(=O)n4C)CCO3)cc2)C1 |
| InChI | InChI=1S/C31H40FN5O2/c1-3-4-5-6-7-8-23-14-16-36(21-23)25-11-9-24(10-12-25)29-22-37(17-18-39-29)31-34-28(19-30(38)35(31)2)26-13-15-33-20-27(26)32/h9-13,15,19-20,23,29H,3-8,14,16-18,21-22H2,1-2H3/t23?,29-/m1/s1 |
| InChIKey | IXRJSGWQFFJYNI-GJQLDDCUSA-N |
| XLogP | 5.75 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|