C22H20FN5O2 — CID 87412074
6-(3-fluoro-4-pyridinyl)-2-[(2S)-2-(4-isocyanophenyl)-1,4-oxazepan-4-yl]-3-methylpyrimidin-4-one (PubChem CID 87412074) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is 6-(3-fluoro-4-pyridinyl)-2-[(2S)-2-(4-isocyanophenyl)-1,4-oxazepan-4-yl]-3-methylpyrimidin-4-one.
| Compound Name | 6-(3-fluoro-4-pyridinyl)-2-[(2S)-2-(4-isocyanophenyl)-1,4-oxazepan-4-yl]-3-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 87412074 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 6-(3-fluoro-4-pyridinyl)-2-[(2S)-2-(4-isocyanophenyl)-1,4-oxazepan-4-yl]-3-methylpyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc([C@H]2CN(c3nc(-c4ccncc4F)cc(=O)n3C)CCCO2)cc1 |
| InChI | InChI=1S/C22H20FN5O2/c1-24-16-6-4-15(5-7-16)20-14-28(10-3-11-30-20)22-26-19(12-21(29)27(22)2)17-8-9-25-13-18(17)23/h4-9,12-13,20H,3,10-11,14H2,2H3/t20-/m1/s1 |
| InChIKey | KMSJMFSAPBVUIT-HXUWFJFHSA-N |
| XLogP | 3.50 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|